C27H48N2O7 — CID 70692993
(3S,5R,8R,9S,10S,13R,14S,17S)-17-[[2-(dimethylamino)ethoxy-methylamino]methyl]-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,14-diol;oxalic acid (PubChem CID 70692993) has the molecular formula C27H48N2O7 and a molecular weight of 512.69 g/mol. Its IUPAC name is (3S,5R,8R,9S,10S,13R,14S,17S)-17-[[2-(dimethylamino)ethoxy-methylamino]methyl]-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,14-diol;oxalic acid.
| Compound Name | (3S,5R,8R,9S,10S,13R,14S,17S)-17-[[2-(dimethylamino)ethoxy-methylamino]methyl]-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,14-diol;oxalic acid |
|---|---|
| PubChem CID | 70692993 |
| Molecular Formula | C27H48N2O7 |
| Molecular Weight | 512.69 g/mol |
| Exact Mass | 512.35 |
| IUPAC Name | (3S,5R,8R,9S,10S,13R,14S,17S)-17-[[2-(dimethylamino)ethoxy-methylamino]methyl]-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15,16,17-tetradecahydrocyclopenta[a]phenanthrene-3,14-diol;oxalic acid |
| SMILES | CN(C)CCON(C)C[C@H]1CC[C@]2(O)[C@@H]3CC[C@@H]4C[C@@H](O)CC[C@]4(C)[C@H]3CC[C@]12C.O=C(O)C(=O)O |
| InChI | InChI=1S/C25H46N2O3.C2H2O4/c1-23-11-9-20(28)16-18(23)6-7-22-21(23)10-12-24(2)19(8-13-25(22,24)29)17-27(5)30-15-14-26(3)4;3-1(4)2(5)6/h18-22,28-29H,6-17H2,1-5H3;(H,3,4)(H,5,6)/t18-,19-,20+,21+,22-,23+,24-,25+;/m1./s1 |
| InChIKey | NMJHYNCDMDXARD-ZJIMLRMNSA-N |
| XLogP | 2.70 |
| TPSA | 130.77 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.69 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|