C23H40N2O3 — CID 57206198
(8R,9R,10S,13R,14R)-17-[2-(dimethylamino)ethoxyamino]-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15-dodecahydrocyclopenta[a]phenanthrene-3,14-diol (PubChem CID 57206198) has the molecular formula C23H40N2O3 and a molecular weight of 392.58 g/mol. Its IUPAC name is (8R,9R,10S,13R,14R)-17-[2-(dimethylamino)ethoxyamino]-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15-dodecahydrocyclopenta[a]phenanthrene-3,14-diol.
| Compound Name | (8R,9R,10S,13R,14R)-17-[2-(dimethylamino)ethoxyamino]-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15-dodecahydrocyclopenta[a]phenanthrene-3,14-diol |
|---|---|
| PubChem CID | 57206198 |
| Molecular Formula | C23H40N2O3 |
| Molecular Weight | 392.58 g/mol |
| Exact Mass | 392.30 |
| IUPAC Name | (8R,9R,10S,13R,14R)-17-[2-(dimethylamino)ethoxyamino]-10,13-dimethyl-1,2,3,4,5,6,7,8,9,11,12,15-dodecahydrocyclopenta[a]phenanthrene-3,14-diol |
| SMILES | CN(C)CCONC1=CC[C@@]2(O)[C@@H]3CCC4CC(O)CC[C@]4(C)[C@@H]3CC[C@]12C |
| InChI | InChI=1S/C23H40N2O3/c1-21-10-7-17(26)15-16(21)5-6-19-18(21)8-11-22(2)20(9-12-23(19,22)27)24-28-14-13-25(3)4/h9,16-19,24,26-27H,5-8,10-15H2,1-4H3/t16?,17?,18-,19-,21+,22-,23-/m1/s1 |
| InChIKey | QPFZULMSODRERV-YFUPACIZSA-N |
| XLogP | 3.08 |
| TPSA | 64.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.58 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|