C11H12BrNO3S — CID 70057676
cyclopropyl (6S)-3-(bromomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate (PubChem CID 70057676) has the molecular formula C11H12BrNO3S and a molecular weight of 318.19 g/mol. Its IUPAC name is cyclopropyl (6S)-3-(bromomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate.
| Compound Name | cyclopropyl (6S)-3-(bromomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
|---|---|
| PubChem CID | 70057676 |
| Molecular Formula | C11H12BrNO3S |
| Molecular Weight | 318.19 g/mol |
| Exact Mass | 316.97 |
| IUPAC Name | cyclopropyl (6S)-3-(bromomethyl)-8-oxo-5-thia-1-azabicyclo[4.2.0]oct-2-ene-2-carboxylate |
| SMILES | O=C(OC1CC1)C1=C(CBr)CS[C@H]2CC(=O)N12 |
| InChI | InChI=1S/C11H12BrNO3S/c12-4-6-5-17-9-3-8(14)13(9)10(6)11(15)16-7-1-2-7/h7,9H,1-5H2/t9-/m0/s1 |
| InChIKey | GQLMIXSVHQZQAS-VIFPVBQESA-N |
| XLogP | 1.65 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.19 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|