C13H16Br2N2O3 — CID 70059203
(3,5-dibromophenyl) 2-[[(2-aminoacetyl)amino]methyl]butanoate (PubChem CID 70059203) has the molecular formula C13H16Br2N2O3 and a molecular weight of 408.09 g/mol. Its IUPAC name is (3,5-dibromophenyl) 2-[[(2-aminoacetyl)amino]methyl]butanoate.
| Compound Name | (3,5-dibromophenyl) 2-[[(2-aminoacetyl)amino]methyl]butanoate |
|---|---|
| PubChem CID | 70059203 |
| Molecular Formula | C13H16Br2N2O3 |
| Molecular Weight | 408.09 g/mol |
| Exact Mass | 405.95 |
| IUPAC Name | (3,5-dibromophenyl) 2-[[(2-aminoacetyl)amino]methyl]butanoate |
| SMILES | CCC(CNC(=O)CN)C(=O)Oc1cc(Br)cc(Br)c1 |
| InChI | InChI=1S/C13H16Br2N2O3/c1-2-8(7-17-12(18)6-16)13(19)20-11-4-9(14)3-10(15)5-11/h3-5,8H,2,6-7,16H2,1H3,(H,17,18) |
| InChIKey | OSLZKTMJVSXRKT-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 81.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.09 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|