C32H30N6O8S4 — CID 70059267
2-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]-N-phenylthiophene-3-carboxamide (PubChem CID 70059267) has the molecular formula C32H30N6O8S4 and a molecular weight of 754.89 g/mol. Its IUPAC name is 2-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]-N-phenylthiophene-3-carboxamide.
| Compound Name | 2-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]-N-phenylthiophene-3-carboxamide |
|---|---|
| PubChem CID | 70059267 |
| Molecular Formula | C32H30N6O8S4 |
| Molecular Weight | 754.89 g/mol |
| Exact Mass | 754.10 |
| IUPAC Name | 2-[(3,4-dimethyl-1,2-oxazol-5-yl)sulfamoyl]-N-phenylthiophene-3-carboxamide |
| SMILES | Cc1noc(NS(=O)(=O)c2sccc2C(=O)Nc2ccccc2)c1C.Cc1noc(NS(=O)(=O)c2sccc2C(=O)Nc2ccccc2)c1C |
| InChI | InChI=1S/2C16H15N3O4S2/c2*1-10-11(2)18-23-15(10)19-25(21,22)16-13(8-9-24-16)14(20)17-12-6-4-3-5-7-12/h2*3-9,19H,1-2H3,(H,17,20) |
| InChIKey | LFLJNUWAZKQBEZ-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 202.60 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 50 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 754.89 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |