C26H29N3O4 — CID 70059350
benzyl (2S)-2-(azepane-1-carbonylamino)-3-(1-formylindol-3-yl)propanoate (PubChem CID 70059350) has the molecular formula C26H29N3O4 and a molecular weight of 447.54 g/mol. Its IUPAC name is benzyl (2S)-2-(azepane-1-carbonylamino)-3-(1-formylindol-3-yl)propanoate.
| Compound Name | benzyl (2S)-2-(azepane-1-carbonylamino)-3-(1-formylindol-3-yl)propanoate |
|---|---|
| PubChem CID | 70059350 |
| Molecular Formula | C26H29N3O4 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | benzyl (2S)-2-(azepane-1-carbonylamino)-3-(1-formylindol-3-yl)propanoate |
| SMILES | O=Cn1cc(C[C@H](NC(=O)N2CCCCCC2)C(=O)OCc2ccccc2)c2ccccc21 |
| InChI | InChI=1S/C26H29N3O4/c30-19-29-17-21(22-12-6-7-13-24(22)29)16-23(25(31)33-18-20-10-4-3-5-11-20)27-26(32)28-14-8-1-2-9-15-28/h3-7,10-13,17,19,23H,1-2,8-9,14-16,18H2,(H,27,32)/t23-/m0/s1 |
| InChIKey | YONUTGNVWKKOCL-QHCPKHFHSA-N |
| XLogP | 3.92 |
| TPSA | 80.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|