C27H19ClN2O2 — CID 70059578
2-chloro-4-(6H-phenanthridine-5-carbonyl)-N-phenylbenzamide (PubChem CID 70059578) has the molecular formula C27H19ClN2O2 and a molecular weight of 438.91 g/mol. Its IUPAC name is 2-chloro-4-(6H-phenanthridine-5-carbonyl)-N-phenylbenzamide.
| Compound Name | 2-chloro-4-(6H-phenanthridine-5-carbonyl)-N-phenylbenzamide |
|---|---|
| PubChem CID | 70059578 |
| Molecular Formula | C27H19ClN2O2 |
| Molecular Weight | 438.91 g/mol |
| Exact Mass | 438.11 |
| IUPAC Name | 2-chloro-4-(6H-phenanthridine-5-carbonyl)-N-phenylbenzamide |
| SMILES | O=C(Nc1ccccc1)c1ccc(C(=O)N2Cc3ccccc3-c3ccccc32)cc1Cl |
| InChI | InChI=1S/C27H19ClN2O2/c28-24-16-18(14-15-23(24)26(31)29-20-9-2-1-3-10-20)27(32)30-17-19-8-4-5-11-21(19)22-12-6-7-13-25(22)30/h1-16H,17H2,(H,29,31) |
| InChIKey | KVNMGFWRHRPGJR-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.91 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |