C24H17ClN2O3 — CID 54510181
N-[3-chloro-4-(phenylcarbamoyl)phenyl]-6-hydroxynaphthalene-2-carboxamide (PubChem CID 54510181) has the molecular formula C24H17ClN2O3 and a molecular weight of 416.86 g/mol. Its IUPAC name is N-[3-chloro-4-(phenylcarbamoyl)phenyl]-6-hydroxynaphthalene-2-carboxamide.
| Compound Name | N-[3-chloro-4-(phenylcarbamoyl)phenyl]-6-hydroxynaphthalene-2-carboxamide |
|---|---|
| PubChem CID | 54510181 |
| Molecular Formula | C24H17ClN2O3 |
| Molecular Weight | 416.86 g/mol |
| Exact Mass | 416.09 |
| IUPAC Name | N-[3-chloro-4-(phenylcarbamoyl)phenyl]-6-hydroxynaphthalene-2-carboxamide |
| SMILES | O=C(Nc1ccc(C(=O)Nc2ccccc2)c(Cl)c1)c1ccc2cc(O)ccc2c1 |
| InChI | InChI=1S/C24H17ClN2O3/c25-22-14-19(9-11-21(22)24(30)26-18-4-2-1-3-5-18)27-23(29)17-7-6-16-13-20(28)10-8-15(16)12-17/h1-14,28H,(H,26,30)(H,27,29) |
| InChIKey | RAVXOKUUBMORGT-UHFFFAOYSA-N |
| XLogP | 5.70 |
| TPSA | 78.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.86 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |