C42H28N2O8 — CID 58445021
[4-[[3-[4-[(6-hydroxynaphthalene-2-carbonyl)amino]phenoxy]carbonylbenzoyl]amino]phenyl] 6-hydroxynaphthalene-2-carboxylate (PubChem CID 58445021) has the molecular formula C42H28N2O8 and a molecular weight of 688.69 g/mol. Its IUPAC name is [4-[[3-[4-[(6-hydroxynaphthalene-2-carbonyl)amino]phenoxy]carbonylbenzoyl]amino]phenyl] 6-hydroxynaphthalene-2-carboxylate.
| Compound Name | [4-[[3-[4-[(6-hydroxynaphthalene-2-carbonyl)amino]phenoxy]carbonylbenzoyl]amino]phenyl] 6-hydroxynaphthalene-2-carboxylate |
|---|---|
| PubChem CID | 58445021 |
| Molecular Formula | C42H28N2O8 |
| Molecular Weight | 688.69 g/mol |
| Exact Mass | 688.18 |
| IUPAC Name | [4-[[3-[4-[(6-hydroxynaphthalene-2-carbonyl)amino]phenoxy]carbonylbenzoyl]amino]phenyl] 6-hydroxynaphthalene-2-carboxylate |
| SMILES | O=C(Nc1ccc(OC(=O)c2ccc3cc(O)ccc3c2)cc1)c1cccc(C(=O)Oc2ccc(NC(=O)c3ccc4cc(O)ccc4c3)cc2)c1 |
| InChI | InChI=1S/C42H28N2O8/c45-35-14-8-25-20-30(6-4-27(25)23-35)40(48)44-34-12-16-37(17-13-34)51-41(49)31-3-1-2-29(22-31)39(47)43-33-10-18-38(19-11-33)52-42(50)32-7-5-28-24-36(46)15-9-26(28)21-32/h1-24,45-46H,(H,43,47)(H,44,48) |
| InChIKey | PRKALUQRKMBQCO-UHFFFAOYSA-N |
| XLogP | 8.35 |
| TPSA | 151.26 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 688.69 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|