C27H18Cl2N2O2 — CID 70059373
2,4-dichloro-N-[4-(6H-phenanthridine-5-carbonyl)phenyl]benzamide (PubChem CID 70059373) has the molecular formula C27H18Cl2N2O2 and a molecular weight of 473.36 g/mol. Its IUPAC name is 2,4-dichloro-N-[4-(6H-phenanthridine-5-carbonyl)phenyl]benzamide.
| Compound Name | 2,4-dichloro-N-[4-(6H-phenanthridine-5-carbonyl)phenyl]benzamide |
|---|---|
| PubChem CID | 70059373 |
| Molecular Formula | C27H18Cl2N2O2 |
| Molecular Weight | 473.36 g/mol |
| Exact Mass | 472.07 |
| IUPAC Name | 2,4-dichloro-N-[4-(6H-phenanthridine-5-carbonyl)phenyl]benzamide |
| SMILES | O=C(Nc1ccc(C(=O)N2Cc3ccccc3-c3ccccc32)cc1)c1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C27H18Cl2N2O2/c28-19-11-14-23(24(29)15-19)26(32)30-20-12-9-17(10-13-20)27(33)31-16-18-5-1-2-6-21(18)22-7-3-4-8-25(22)31/h1-15H,16H2,(H,30,32) |
| InChIKey | JCPYAUIRNVJMJE-UHFFFAOYSA-N |
| XLogP | 7.07 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.36 |
| LogP ≤ 5 | 7.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |