C31H42N6O5 — CID 70061858
[1-[3-[1-[2-(benzylamino)pyrimidin-4-yl]piperidin-4-yl]-2-oxo-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-7-yl]piperidin-4-yl] ethyl carbonate (PubChem CID 70061858) has the molecular formula C31H42N6O5 and a molecular weight of 578.71 g/mol. Its IUPAC name is [1-[3-[1-[2-(benzylamino)pyrimidin-4-yl]piperidin-4-yl]-2-oxo-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-7-yl]piperidin-4-yl] ethyl carbonate.
| Compound Name | [1-[3-[1-[2-(benzylamino)pyrimidin-4-yl]piperidin-4-yl]-2-oxo-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-7-yl]piperidin-4-yl] ethyl carbonate |
|---|---|
| PubChem CID | 70061858 |
| Molecular Formula | C31H42N6O5 |
| Molecular Weight | 578.71 g/mol |
| Exact Mass | 578.32 |
| IUPAC Name | [1-[3-[1-[2-(benzylamino)pyrimidin-4-yl]piperidin-4-yl]-2-oxo-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-7-yl]piperidin-4-yl] ethyl carbonate |
| SMILES | CCOC(=O)OC1CCN(C2CCCC3C2OC(=O)N3C2CCN(c3ccnc(NCc4ccccc4)n3)CC2)CC1 |
| InChI | InChI=1S/C31H42N6O5/c1-2-40-31(39)41-24-14-19-35(20-15-24)25-9-6-10-26-28(25)42-30(38)37(26)23-12-17-36(18-13-23)27-11-16-32-29(34-27)33-21-22-7-4-3-5-8-22/h3-5,7-8,11,16,23-26,28H,2,6,9-10,12-15,17-21H2,1H3,(H,32,33,34) |
| InChIKey | JADIYOQOFMSORO-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 109.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.71 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |