C25H35N5O5 — CID 57117079
[1-[2-acetylimino-3-(1-pyridin-4-ylpiperidin-4-yl)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-7-yl]piperidin-4-yl] hydrogen carbonate (PubChem CID 57117079) has the molecular formula C25H35N5O5 and a molecular weight of 485.59 g/mol. Its IUPAC name is [1-[2-acetylimino-3-(1-pyridin-4-ylpiperidin-4-yl)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-7-yl]piperidin-4-yl] hydrogen carbonate.
| Compound Name | [1-[2-acetylimino-3-(1-pyridin-4-ylpiperidin-4-yl)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-7-yl]piperidin-4-yl] hydrogen carbonate |
|---|---|
| PubChem CID | 57117079 |
| Molecular Formula | C25H35N5O5 |
| Molecular Weight | 485.59 g/mol |
| Exact Mass | 485.26 |
| IUPAC Name | [1-[2-acetylimino-3-(1-pyridin-4-ylpiperidin-4-yl)-3a,4,5,6,7,7a-hexahydro-1,3-benzoxazol-7-yl]piperidin-4-yl] hydrogen carbonate |
| SMILES | CC(=O)/N=C1\OC2C(N3CCC(OC(=O)O)CC3)CCCC2N1C1CCN(c2ccncc2)CC1 |
| InChI | InChI=1S/C25H35N5O5/c1-17(31)27-24-30(19-7-13-28(14-8-19)18-5-11-26-12-6-18)22-4-2-3-21(23(22)35-24)29-15-9-20(10-16-29)34-25(32)33/h5-6,11-12,19-23H,2-4,7-10,13-16H2,1H3,(H,32,33)/b27-24- |
| InChIKey | CDHZSYXHRBQWOY-PNHLSOANSA-N |
| XLogP | 2.73 |
| TPSA | 107.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.59 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|