C16H22N4O3 — CID 67646655
(1-pyridin-4-ylpiperidin-4-yl) 2-oxo-1,3-diazepane-4-carboxylate (PubChem CID 67646655) has the molecular formula C16H22N4O3 and a molecular weight of 318.38 g/mol. Its IUPAC name is (1-pyridin-4-ylpiperidin-4-yl) 2-oxo-1,3-diazepane-4-carboxylate.
| Compound Name | (1-pyridin-4-ylpiperidin-4-yl) 2-oxo-1,3-diazepane-4-carboxylate |
|---|---|
| PubChem CID | 67646655 |
| Molecular Formula | C16H22N4O3 |
| Molecular Weight | 318.38 g/mol |
| Exact Mass | 318.17 |
| IUPAC Name | (1-pyridin-4-ylpiperidin-4-yl) 2-oxo-1,3-diazepane-4-carboxylate |
| SMILES | O=C1NCCCC(C(=O)OC2CCN(c3ccncc3)CC2)N1 |
| InChI | InChI=1S/C16H22N4O3/c21-15(14-2-1-7-18-16(22)19-14)23-13-5-10-20(11-6-13)12-3-8-17-9-4-12/h3-4,8-9,13-14H,1-2,5-7,10-11H2,(H2,18,19,22) |
| InChIKey | MTTNYYGGWWKSJL-UHFFFAOYSA-N |
| XLogP | 1.06 |
| TPSA | 83.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.38 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |