C32H47N3O2 — CID 70062190
2-(3-methoxyphenyl)-2-[6-(3-methoxyphenyl)-4-(methyldiazenyl)hexyl]undecanenitrile (PubChem CID 70062190) has the molecular formula C32H47N3O2 and a molecular weight of 505.75 g/mol. Its IUPAC name is 2-(3-methoxyphenyl)-2-[6-(3-methoxyphenyl)-4-(methyldiazenyl)hexyl]undecanenitrile.
| Compound Name | 2-(3-methoxyphenyl)-2-[6-(3-methoxyphenyl)-4-(methyldiazenyl)hexyl]undecanenitrile |
|---|---|
| PubChem CID | 70062190 |
| Molecular Formula | C32H47N3O2 |
| Molecular Weight | 505.75 g/mol |
| Exact Mass | 505.37 |
| IUPAC Name | 2-(3-methoxyphenyl)-2-[6-(3-methoxyphenyl)-4-(methyldiazenyl)hexyl]undecanenitrile |
| SMILES | CCCCCCCCCC(C#N)(CCCC(CCc1cccc(OC)c1)/N=N\C)c1cccc(OC)c1 |
| InChI | InChI=1S/C32H47N3O2/c1-5-6-7-8-9-10-11-22-32(26-33,28-16-13-19-31(25-28)37-4)23-14-17-29(35-34-2)21-20-27-15-12-18-30(24-27)36-3/h12-13,15-16,18-19,24-25,29H,5-11,14,17,20-23H2,1-4H3/b35-34- |
| InChIKey | FGOUEKXKHWXDDY-KNWKATPGSA-N |
| XLogP | 8.86 |
| TPSA | 66.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.75 |
| LogP ≤ 5 | 8.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|