C34H51N3O2 — CID 70063216
2,8-bis(3-methoxyphenyl)-6-(methyldiazenyl)-2-undecan-6-yloctanenitrile (PubChem CID 70063216) has the molecular formula C34H51N3O2 and a molecular weight of 533.80 g/mol. Its IUPAC name is 2,8-bis(3-methoxyphenyl)-6-(methyldiazenyl)-2-undecan-6-yloctanenitrile.
| Compound Name | 2,8-bis(3-methoxyphenyl)-6-(methyldiazenyl)-2-undecan-6-yloctanenitrile |
|---|---|
| PubChem CID | 70063216 |
| Molecular Formula | C34H51N3O2 |
| Molecular Weight | 533.80 g/mol |
| Exact Mass | 533.40 |
| IUPAC Name | 2,8-bis(3-methoxyphenyl)-6-(methyldiazenyl)-2-undecan-6-yloctanenitrile |
| SMILES | CCCCCC(CCCCC)C(C#N)(CCCC(CCc1cccc(OC)c1)/N=N\C)c1cccc(OC)c1 |
| InChI | InChI=1S/C34H51N3O2/c1-6-8-10-16-29(17-11-9-7-2)34(27-35,30-18-13-21-33(26-30)39-5)24-14-19-31(37-36-3)23-22-28-15-12-20-32(25-28)38-4/h12-13,15,18,20-21,25-26,29,31H,6-11,14,16-17,19,22-24H2,1-5H3/b37-36- |
| InChIKey | SCAOVXFZRFHSDX-KRYSQPQISA-N |
| XLogP | 9.50 |
| TPSA | 66.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.80 |
| LogP ≤ 5 | 9.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|