C35H53ClN4O3 — CID 67920340
(6R)-2-(3,4-dimethoxyphenyl)-8-(3-methoxyphenyl)-6-(methyldiazenyl)-2-propan-2-yloctanenitrile;2-propan-2-ylpentanenitrile;hydrochloride (PubChem CID 67920340) has the molecular formula C35H53ClN4O3 and a molecular weight of 613.29 g/mol. Its IUPAC name is (6R)-2-(3,4-dimethoxyphenyl)-8-(3-methoxyphenyl)-6-(methyldiazenyl)-2-propan-2-yloctanenitrile;2-propan-2-ylpentanenitrile;hydrochloride.
| Compound Name | (6R)-2-(3,4-dimethoxyphenyl)-8-(3-methoxyphenyl)-6-(methyldiazenyl)-2-propan-2-yloctanenitrile;2-propan-2-ylpentanenitrile;hydrochloride |
|---|---|
| PubChem CID | 67920340 |
| Molecular Formula | C35H53ClN4O3 |
| Molecular Weight | 613.29 g/mol |
| Exact Mass | 612.38 |
| IUPAC Name | (6R)-2-(3,4-dimethoxyphenyl)-8-(3-methoxyphenyl)-6-(methyldiazenyl)-2-propan-2-yloctanenitrile;2-propan-2-ylpentanenitrile;hydrochloride |
| SMILES | C/N=N/[C@H](CCCC(C#N)(c1ccc(OC)c(OC)c1)C(C)C)CCc1cccc(OC)c1.CCCC(C#N)C(C)C.Cl |
| InChI | InChI=1S/C27H37N3O3.C8H15N.ClH/c1-20(2)27(19-28,22-13-15-25(32-5)26(18-22)33-6)16-8-10-23(30-29-3)14-12-21-9-7-11-24(17-21)31-4;1-4-5-8(6-9)7(2)3;/h7,9,11,13,15,17-18,20,23H,8,10,12,14,16H2,1-6H3;7-8H,4-5H2,1-3H3;1H/b30-29+;;/t23-,27?;;/m1../s1 |
| InChIKey | NOCZCFOZQJXEDQ-UMSKKQSJSA-N |
| XLogP | 9.39 |
| TPSA | 99.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.29 |
| LogP ≤ 5 | 9.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|