C17H16Cl2N2O2 — CID 70062971
(2R)-2-[[4-(3,5-dichlorophenyl)phenyl]methyl]butanediamide (PubChem CID 70062971) has the molecular formula C17H16Cl2N2O2 and a molecular weight of 351.23 g/mol. Its IUPAC name is (2R)-2-[[4-(3,5-dichlorophenyl)phenyl]methyl]butanediamide.
| Compound Name | (2R)-2-[[4-(3,5-dichlorophenyl)phenyl]methyl]butanediamide |
|---|---|
| PubChem CID | 70062971 |
| Molecular Formula | C17H16Cl2N2O2 |
| Molecular Weight | 351.23 g/mol |
| Exact Mass | 350.06 |
| IUPAC Name | (2R)-2-[[4-(3,5-dichlorophenyl)phenyl]methyl]butanediamide |
| SMILES | NC(=O)C[C@@H](Cc1ccc(-c2cc(Cl)cc(Cl)c2)cc1)C(N)=O |
| InChI | InChI=1S/C17H16Cl2N2O2/c18-14-6-12(7-15(19)9-14)11-3-1-10(2-4-11)5-13(17(21)23)8-16(20)22/h1-4,6-7,9,13H,5,8H2,(H2,20,22)(H2,21,23)/t13-/m1/s1 |
| InChIKey | NPHQELWJPQENOA-CYBMUJFWSA-N |
| XLogP | 3.18 |
| TPSA | 86.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.23 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |