C26H51NO5Si — CID 70065877
(2S,4S)-2-(butoxycarbonylamino)-4-[tert-butyl(dimethyl)silyl]oxy-6-cyclohexyl-2-propan-2-ylhexanoic acid (PubChem CID 70065877) has the molecular formula C26H51NO5Si and a molecular weight of 485.78 g/mol. Its IUPAC name is (2S,4S)-2-(butoxycarbonylamino)-4-[tert-butyl(dimethyl)silyl]oxy-6-cyclohexyl-2-propan-2-ylhexanoic acid.
| Compound Name | (2S,4S)-2-(butoxycarbonylamino)-4-[tert-butyl(dimethyl)silyl]oxy-6-cyclohexyl-2-propan-2-ylhexanoic acid |
|---|---|
| PubChem CID | 70065877 |
| Molecular Formula | C26H51NO5Si |
| Molecular Weight | 485.78 g/mol |
| Exact Mass | 485.35 |
| IUPAC Name | (2S,4S)-2-(butoxycarbonylamino)-4-[tert-butyl(dimethyl)silyl]oxy-6-cyclohexyl-2-propan-2-ylhexanoic acid |
| SMILES | CCCCOC(=O)N[C@](C[C@H](CCC1CCCCC1)O[Si](C)(C)C(C)(C)C)(C(=O)O)C(C)C |
| InChI | InChI=1S/C26H51NO5Si/c1-9-10-18-31-24(30)27-26(20(2)3,23(28)29)19-22(32-33(7,8)25(4,5)6)17-16-21-14-12-11-13-15-21/h20-22H,9-19H2,1-8H3,(H,27,30)(H,28,29)/t22-,26-/m0/s1 |
| InChIKey | WIMVQSUKOJLTTQ-NVQXNPDNSA-N |
| XLogP | 7.13 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.78 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|