C15H16F3NO4 — CID 70069923
(3aR)-7-(4,4,4-trifluoro-3-hydroxybutoxy)-3,3a,4,5-tetrahydro-[1,3]oxazolo[3,4-a]quinolin-1-one (PubChem CID 70069923) has the molecular formula C15H16F3NO4 and a molecular weight of 331.29 g/mol. Its IUPAC name is (3aR)-7-(4,4,4-trifluoro-3-hydroxybutoxy)-3,3a,4,5-tetrahydro-[1,3]oxazolo[3,4-a]quinolin-1-one.
| Compound Name | (3aR)-7-(4,4,4-trifluoro-3-hydroxybutoxy)-3,3a,4,5-tetrahydro-[1,3]oxazolo[3,4-a]quinolin-1-one |
|---|---|
| PubChem CID | 70069923 |
| Molecular Formula | C15H16F3NO4 |
| Molecular Weight | 331.29 g/mol |
| Exact Mass | 331.10 |
| IUPAC Name | (3aR)-7-(4,4,4-trifluoro-3-hydroxybutoxy)-3,3a,4,5-tetrahydro-[1,3]oxazolo[3,4-a]quinolin-1-one |
| SMILES | O=C1OC[C@H]2CCc3cc(OCCC(O)C(F)(F)F)ccc3N12 |
| InChI | InChI=1S/C15H16F3NO4/c16-15(17,18)13(20)5-6-22-11-3-4-12-9(7-11)1-2-10-8-23-14(21)19(10)12/h3-4,7,10,13,20H,1-2,5-6,8H2/t10-,13?/m1/s1 |
| InChIKey | BYFCXYGRUBUGDN-VUUHIHSGSA-N |
| XLogP | 2.65 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.29 |
| LogP ≤ 5 | 2.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |