C28H26F3NO4 — CID 150923837
(3R)-3-phenyl-7-(4,4,4-trifluoro-3-phenylmethoxybutoxy)-3,3a,4,5-tetrahydro-[1,3]oxazolo[3,4-a]quinolin-1-one (PubChem CID 150923837) has the molecular formula C28H26F3NO4 and a molecular weight of 497.51 g/mol. Its IUPAC name is (3R)-3-phenyl-7-(4,4,4-trifluoro-3-phenylmethoxybutoxy)-3,3a,4,5-tetrahydro-[1,3]oxazolo[3,4-a]quinolin-1-one.
| Compound Name | (3R)-3-phenyl-7-(4,4,4-trifluoro-3-phenylmethoxybutoxy)-3,3a,4,5-tetrahydro-[1,3]oxazolo[3,4-a]quinolin-1-one |
|---|---|
| PubChem CID | 150923837 |
| Molecular Formula | C28H26F3NO4 |
| Molecular Weight | 497.51 g/mol |
| Exact Mass | 497.18 |
| IUPAC Name | (3R)-3-phenyl-7-(4,4,4-trifluoro-3-phenylmethoxybutoxy)-3,3a,4,5-tetrahydro-[1,3]oxazolo[3,4-a]quinolin-1-one |
| SMILES | O=C1O[C@H](c2ccccc2)C2CCc3cc(OCCC(OCc4ccccc4)C(F)(F)F)ccc3N12 |
| InChI | InChI=1S/C28H26F3NO4/c29-28(30,31)25(35-18-19-7-3-1-4-8-19)15-16-34-22-12-14-23-21(17-22)11-13-24-26(36-27(33)32(23)24)20-9-5-2-6-10-20/h1-10,12,14,17,24-26H,11,13,15-16,18H2/t24?,25?,26-/m1/s1 |
| InChIKey | LEPBPAKRIVFUFE-NRUKRLKBSA-N |
| XLogP | 6.62 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.51 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |