C24H26F3NO5 — CID 19039857
3-(methoxymethyl)-7-(4,4,4-trifluoro-3-phenylmethoxybutoxy)-3,3a,4,5-tetrahydro-[1,3]oxazolo[3,4-a]quinolin-1-one (PubChem CID 19039857) has the molecular formula C24H26F3NO5 and a molecular weight of 465.47 g/mol. Its IUPAC name is 3-(methoxymethyl)-7-(4,4,4-trifluoro-3-phenylmethoxybutoxy)-3,3a,4,5-tetrahydro-[1,3]oxazolo[3,4-a]quinolin-1-one.
| Compound Name | 3-(methoxymethyl)-7-(4,4,4-trifluoro-3-phenylmethoxybutoxy)-3,3a,4,5-tetrahydro-[1,3]oxazolo[3,4-a]quinolin-1-one |
|---|---|
| PubChem CID | 19039857 |
| Molecular Formula | C24H26F3NO5 |
| Molecular Weight | 465.47 g/mol |
| Exact Mass | 465.18 |
| IUPAC Name | 3-(methoxymethyl)-7-(4,4,4-trifluoro-3-phenylmethoxybutoxy)-3,3a,4,5-tetrahydro-[1,3]oxazolo[3,4-a]quinolin-1-one |
| SMILES | COCC1OC(=O)N2c3ccc(OCCC(OCc4ccccc4)C(F)(F)F)cc3CCC12 |
| InChI | InChI=1S/C24H26F3NO5/c1-30-15-21-20-9-7-17-13-18(8-10-19(17)28(20)23(29)33-21)31-12-11-22(24(25,26)27)32-14-16-5-3-2-4-6-16/h2-6,8,10,13,20-22H,7,9,11-12,14-15H2,1H3 |
| InChIKey | SGKLBPGTSQHFLX-UHFFFAOYSA-N |
| XLogP | 4.89 |
| TPSA | 57.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 465.47 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |