C6H10N2O4 — CID 70072586
(3R)-diazinane-3,4-dicarboxylic acid (PubChem CID 70072586) has the molecular formula C6H10N2O4 and a molecular weight of 174.16 g/mol. Its IUPAC name is (3R)-diazinane-3,4-dicarboxylic acid.
| Compound Name | (3R)-diazinane-3,4-dicarboxylic acid |
|---|---|
| PubChem CID | 70072586 |
| Molecular Formula | C6H10N2O4 |
| Molecular Weight | 174.16 g/mol |
| Exact Mass | 174.06 |
| IUPAC Name | (3R)-diazinane-3,4-dicarboxylic acid |
| SMILES | O=C(O)C1CCNN[C@H]1C(=O)O |
| InChI | InChI=1S/C6H10N2O4/c9-5(10)3-1-2-7-8-4(3)6(11)12/h3-4,7-8H,1-2H2,(H,9,10)(H,11,12)/t3?,4-/m1/s1 |
| InChIKey | GADAHAZRXLUJDA-SRBOSORUSA-N |
| XLogP | -1.36 |
| TPSA | 98.66 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.16 |
| LogP ≤ 5 | -1.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |