C7H10N2O6 — CID 141079262
diazinane-3,4,5-tricarboxylic acid (PubChem CID 141079262) has the molecular formula C7H10N2O6 and a molecular weight of 218.16 g/mol. Its IUPAC name is diazinane-3,4,5-tricarboxylic acid.
| Compound Name | diazinane-3,4,5-tricarboxylic acid |
|---|---|
| PubChem CID | 141079262 |
| Molecular Formula | C7H10N2O6 |
| Molecular Weight | 218.16 g/mol |
| Exact Mass | 218.05 |
| IUPAC Name | diazinane-3,4,5-tricarboxylic acid |
| SMILES | O=C(O)C1CNNC(C(=O)O)C1C(=O)O |
| InChI | InChI=1S/C7H10N2O6/c10-5(11)2-1-8-9-4(7(14)15)3(2)6(12)13/h2-4,8-9H,1H2,(H,10,11)(H,12,13)(H,14,15) |
| InChIKey | VWWKQTSVCPHWRE-UHFFFAOYSA-N |
| XLogP | -2.05 |
| TPSA | 135.96 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.16 |
| LogP ≤ 5 | -2.05 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 5 |