4,5-dihydroxydiazinane-3-carboxylic acid

C5H10N2O4 — CID 45082434

IUPAC4,5-dihydroxydiazinane-3-carboxylic acid
SMILESO=C(O)C1NNCC(O)C1O
InChIInChI=1S/C5H10N2O4/c8-2-1-6-7-3(4(2)9)5(10)11/h2-4,6-9H,1H2,(H,10,11)
InChIKeyZDNVZJKILKPFDY-UHFFFAOYSA-N
MW162.14 g/mol
LogP-2.73
Rot. Bonds1

About 4,5-dihydroxydiazinane-3-carboxylic acid

4,5-dihydroxydiazinane-3-carboxylic acid (PubChem CID 45082434) has the molecular formula C5H10N2O4 and a molecular weight of 162.14 g/mol. Its IUPAC name is 4,5-dihydroxydiazinane-3-carboxylic acid.

Molecular Properties

Compound Name4,5-dihydroxydiazinane-3-carboxylic acid
PubChem CID45082434
Molecular FormulaC5H10N2O4
Molecular Weight162.14 g/mol
Exact Mass162.06
IUPAC Name4,5-dihydroxydiazinane-3-carboxylic acid
SMILESO=C(O)C1NNCC(O)C1O
InChIInChI=1S/C5H10N2O4/c8-2-1-6-7-3(4(2)9)5(10)11/h2-4,6-9H,1H2,(H,10,11)
InChIKeyZDNVZJKILKPFDY-UHFFFAOYSA-N
XLogP-2.73
TPSA101.82 Ų
H-Bond Donors5
H-Bond Acceptors5
Rotatable Bonds1
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500162.14
LogP ≤ 5-2.73
H-Bond Donors ≤ 55
H-Bond Acceptors ≤ 105

Analyze 4,5-dihydroxydiazinane-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Related Compounds

(3R,4R,5S)-4,5-dihydroxydiazinane-3-carboxylic acid
CID 93495387
(3R,4R,5R)-4,5-dihydroxydiazinane-3-carboxylic acid
CID 93495388
diazinane-3,4,5-tricarboxylic acid
CID 141079262
(2S,3S,4R,5R)-3,5-dihydroxy-4-methylpiperidine-2-carboxylic acid
CID 163596404
(3S,5R)-5-hydroxydiazinane-3-carboxylic acid
CID 92557182
(3R)-diazinane-3,4-dicarboxylic acid
CID 70072586
(2S,3R,4S)-4-amino-3-hydroxypyrrolidine-2-carboxylic acid
CID 11744767
(3S,5S)-5-hydroxydiazinane-3-carboxylic acid
CID 11062517
(2S,3R,4R)-4-chloro-3-hydroxypyrrolidine-2-carboxylic acid
CID 68541802
(2S)-3,4-dihydroxy-N,N-dimethylpyrrolidine-2-carboxamide;2,2,2-trifluoroacetic acid
CID 67428099
3-ethyl-4-hydroxypyrrolidine-2-carboxylic acid
CID 155895517
(2R,3R)-piperazine-2,3-dicarboxylic acid
CID 29413693

Frequently Asked Questions

What is the IUPAC name of 4,5-dihydroxydiazinane-3-carboxylic acid?
The IUPAC name of 4,5-dihydroxydiazinane-3-carboxylic acid (CID 45082434) is 4,5-dihydroxydiazinane-3-carboxylic acid.
What is the SMILES notation for 4,5-dihydroxydiazinane-3-carboxylic acid?
The canonical SMILES for 4,5-dihydroxydiazinane-3-carboxylic acid is O=C(O)C1NNCC(O)C1O.
What is the InChIKey of 4,5-dihydroxydiazinane-3-carboxylic acid?
The InChIKey is ZDNVZJKILKPFDY-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H10N2O4/c8-2-1-6-7-3(4(2)9)5(10)11/h2-4,6-9H,1H2,(H,10,11).
What are the key properties of 4,5-dihydroxydiazinane-3-carboxylic acid?
4,5-dihydroxydiazinane-3-carboxylic acid has a molecular weight of 162.14 g/mol, XLogP of -2.73, 1 rotatable bonds, 5 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4,5-dihydroxydiazinane-3-carboxylic acid is sourced from PubChem (CID 45082434), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).