C13H21N2O5P — CID 70073702
5-(2-phenylmethoxycarbonylhydrazinyl)pentylphosphonic acid (PubChem CID 70073702) has the molecular formula C13H21N2O5P and a molecular weight of 316.29 g/mol. Its IUPAC name is 5-(2-phenylmethoxycarbonylhydrazinyl)pentylphosphonic acid.
| Compound Name | 5-(2-phenylmethoxycarbonylhydrazinyl)pentylphosphonic acid |
|---|---|
| PubChem CID | 70073702 |
| Molecular Formula | C13H21N2O5P |
| Molecular Weight | 316.29 g/mol |
| Exact Mass | 316.12 |
| IUPAC Name | 5-(2-phenylmethoxycarbonylhydrazinyl)pentylphosphonic acid |
| SMILES | O=C(NNCCCCCP(=O)(O)O)OCc1ccccc1 |
| InChI | InChI=1S/C13H21N2O5P/c16-13(20-11-12-7-3-1-4-8-12)15-14-9-5-2-6-10-21(17,18)19/h1,3-4,7-8,14H,2,5-6,9-11H2,(H,15,16)(H2,17,18,19) |
| InChIKey | SJOBIIOKFRVILS-UHFFFAOYSA-N |
| XLogP | 1.77 |
| TPSA | 107.89 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.29 |
| LogP ≤ 5 | 1.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|