C13H13FN2O3 — CID 70075367
methyl 3-[3-fluoro-4-(2-oxoimidazolidin-1-yl)phenyl]prop-2-enoate (PubChem CID 70075367) has the molecular formula C13H13FN2O3 and a molecular weight of 264.26 g/mol. Its IUPAC name is methyl 3-[3-fluoro-4-(2-oxoimidazolidin-1-yl)phenyl]prop-2-enoate.
| Compound Name | methyl 3-[3-fluoro-4-(2-oxoimidazolidin-1-yl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 70075367 |
| Molecular Formula | C13H13FN2O3 |
| Molecular Weight | 264.26 g/mol |
| Exact Mass | 264.09 |
| IUPAC Name | methyl 3-[3-fluoro-4-(2-oxoimidazolidin-1-yl)phenyl]prop-2-enoate |
| SMILES | COC(=O)C=Cc1ccc(N2CCNC2=O)c(F)c1 |
| InChI | InChI=1S/C13H13FN2O3/c1-19-12(17)5-3-9-2-4-11(10(14)8-9)16-7-6-15-13(16)18/h2-5,8H,6-7H2,1H3,(H,15,18) |
| InChIKey | MYGSTBLVEXONCI-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 58.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.26 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|