C21H22N4O5S — CID 70078029
N-[3-[(3aS,9bR)-8-cyano-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrol-2-yl]propyl]-4-nitrobenzenesulfonamide (PubChem CID 70078029) has the molecular formula C21H22N4O5S and a molecular weight of 442.50 g/mol. Its IUPAC name is N-[3-[(3aS,9bR)-8-cyano-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrol-2-yl]propyl]-4-nitrobenzenesulfonamide.
| Compound Name | N-[3-[(3aS,9bR)-8-cyano-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrol-2-yl]propyl]-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 70078029 |
| Molecular Formula | C21H22N4O5S |
| Molecular Weight | 442.50 g/mol |
| Exact Mass | 442.13 |
| IUPAC Name | N-[3-[(3aS,9bR)-8-cyano-3,3a,4,9b-tetrahydro-1H-chromeno[3,4-c]pyrrol-2-yl]propyl]-4-nitrobenzenesulfonamide |
| SMILES | N#Cc1ccc2c(c1)[C@@H]1CN(CCCNS(=O)(=O)c3ccc([N+](=O)[O-])cc3)C[C@H]1CO2 |
| InChI | InChI=1S/C21H22N4O5S/c22-11-15-2-7-21-19(10-15)20-13-24(12-16(20)14-30-21)9-1-8-23-31(28,29)18-5-3-17(4-6-18)25(26)27/h2-7,10,16,20,23H,1,8-9,12-14H2/t16-,20+/m0/s1 |
| InChIKey | AAAPFJRWCOJDFS-OXJNMPFZSA-N |
| XLogP | 2.24 |
| TPSA | 125.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.50 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|