C24H34Cl2N2O — CID 70078757
1-(4-methoxyphenyl)-4-[2-(1,2,3,4-tetrahydronaphthalen-1-yl)propyl]piperazine;dihydrochloride (PubChem CID 70078757) has the molecular formula C24H34Cl2N2O and a molecular weight of 437.46 g/mol. Its IUPAC name is 1-(4-methoxyphenyl)-4-[2-(1,2,3,4-tetrahydronaphthalen-1-yl)propyl]piperazine;dihydrochloride.
| Compound Name | 1-(4-methoxyphenyl)-4-[2-(1,2,3,4-tetrahydronaphthalen-1-yl)propyl]piperazine;dihydrochloride |
|---|---|
| PubChem CID | 70078757 |
| Molecular Formula | C24H34Cl2N2O |
| Molecular Weight | 437.46 g/mol |
| Exact Mass | 436.20 |
| IUPAC Name | 1-(4-methoxyphenyl)-4-[2-(1,2,3,4-tetrahydronaphthalen-1-yl)propyl]piperazine;dihydrochloride |
| SMILES | COc1ccc(N2CCN(CC(C)C3CCCc4ccccc43)CC2)cc1.Cl.Cl |
| InChI | InChI=1S/C24H32N2O.2ClH/c1-19(23-9-5-7-20-6-3-4-8-24(20)23)18-25-14-16-26(17-15-25)21-10-12-22(27-2)13-11-21;;/h3-4,6,8,10-13,19,23H,5,7,9,14-18H2,1-2H3;2*1H |
| InChIKey | SDCZZWYUFKEIMO-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.46 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|