C21H30N6O6S — CID 70080219
(2S)-3-[acetyl-[(5R)-3-[3-(1,4,5,6-tetrahydropyrimidin-2-ylamino)propyl]-4,5-dihydro-1,2-oxazol-5-yl]amino]-2-(benzenesulfonamido)propanoic acid (PubChem CID 70080219) has the molecular formula C21H30N6O6S and a molecular weight of 494.57 g/mol. Its IUPAC name is (2S)-3-[acetyl-[(5R)-3-[3-(1,4,5,6-tetrahydropyrimidin-2-ylamino)propyl]-4,5-dihydro-1,2-oxazol-5-yl]amino]-2-(benzenesulfonamido)propanoic acid.
| Compound Name | (2S)-3-[acetyl-[(5R)-3-[3-(1,4,5,6-tetrahydropyrimidin-2-ylamino)propyl]-4,5-dihydro-1,2-oxazol-5-yl]amino]-2-(benzenesulfonamido)propanoic acid |
|---|---|
| PubChem CID | 70080219 |
| Molecular Formula | C21H30N6O6S |
| Molecular Weight | 494.57 g/mol |
| Exact Mass | 494.19 |
| IUPAC Name | (2S)-3-[acetyl-[(5R)-3-[3-(1,4,5,6-tetrahydropyrimidin-2-ylamino)propyl]-4,5-dihydro-1,2-oxazol-5-yl]amino]-2-(benzenesulfonamido)propanoic acid |
| SMILES | CC(=O)N(C[C@H](NS(=O)(=O)c1ccccc1)C(=O)O)[C@H]1CC(CCCNC2=NCCCN2)=NO1 |
| InChI | InChI=1S/C21H30N6O6S/c1-15(28)27(14-18(20(29)30)26-34(31,32)17-8-3-2-4-9-17)19-13-16(25-33-19)7-5-10-22-21-23-11-6-12-24-21/h2-4,8-9,18-19,26H,5-7,10-14H2,1H3,(H,29,30)(H2,22,23,24)/t18-,19+/m0/s1 |
| InChIKey | OAOASEUENXHGPG-RBUKOAKNSA-N |
| XLogP | 0.09 |
| TPSA | 161.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.57 |
| LogP ≤ 5 | 0.09 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|