C32H43N5O6S2 — CID 158776939
(2S)-2-[[(4R)-3-(benzenesulfonyl)-2-ethyl-5,5-dimethyl-1,3-thiazolidine-4-carbonyl]amino]-3-[4-[2-oxo-5-(1,4,5,6-tetrahydropyrimidin-2-ylamino)pentyl]phenyl]propanoic acid (PubChem CID 158776939) has the molecular formula C32H43N5O6S2 and a molecular weight of 657.86 g/mol. Its IUPAC name is (2S)-2-[[(4R)-3-(benzenesulfonyl)-2-ethyl-5,5-dimethyl-1,3-thiazolidine-4-carbonyl]amino]-3-[4-[2-oxo-5-(1,4,5,6-tetrahydropyrimidin-2-ylamino)pentyl]phenyl]propanoic acid.
| Compound Name | (2S)-2-[[(4R)-3-(benzenesulfonyl)-2-ethyl-5,5-dimethyl-1,3-thiazolidine-4-carbonyl]amino]-3-[4-[2-oxo-5-(1,4,5,6-tetrahydropyrimidin-2-ylamino)pentyl]phenyl]propanoic acid |
|---|---|
| PubChem CID | 158776939 |
| Molecular Formula | C32H43N5O6S2 |
| Molecular Weight | 657.86 g/mol |
| Exact Mass | 657.27 |
| IUPAC Name | (2S)-2-[[(4R)-3-(benzenesulfonyl)-2-ethyl-5,5-dimethyl-1,3-thiazolidine-4-carbonyl]amino]-3-[4-[2-oxo-5-(1,4,5,6-tetrahydropyrimidin-2-ylamino)pentyl]phenyl]propanoic acid |
| SMILES | CCC1SC(C)(C)[C@@H](C(=O)N[C@@H](Cc2ccc(CC(=O)CCCNC3=NCCCN3)cc2)C(=O)O)N1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C32H43N5O6S2/c1-4-27-37(45(42,43)25-11-6-5-7-12-25)28(32(2,3)44-27)29(39)36-26(30(40)41)21-23-15-13-22(14-16-23)20-24(38)10-8-17-33-31-34-18-9-19-35-31/h5-7,11-16,26-28H,4,8-10,17-21H2,1-3H3,(H,36,39)(H,40,41)(H2,33,34,35)/t26-,27?,28+/m0/s1 |
| InChIKey | PVOKDIWHJDKMFI-RSTHSURTSA-N |
| XLogP | 2.95 |
| TPSA | 157.27 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 657.86 |
| LogP ≤ 5 | 2.95 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|