C26H29N3O3 — CID 70080374
methyl 2-[3-phenyl-4-(4-pyridin-4-ylpiperazin-1-yl)phenoxy]butanoate (PubChem CID 70080374) has the molecular formula C26H29N3O3 and a molecular weight of 431.54 g/mol. Its IUPAC name is methyl 2-[3-phenyl-4-(4-pyridin-4-ylpiperazin-1-yl)phenoxy]butanoate.
| Compound Name | methyl 2-[3-phenyl-4-(4-pyridin-4-ylpiperazin-1-yl)phenoxy]butanoate |
|---|---|
| PubChem CID | 70080374 |
| Molecular Formula | C26H29N3O3 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | methyl 2-[3-phenyl-4-(4-pyridin-4-ylpiperazin-1-yl)phenoxy]butanoate |
| SMILES | CCC(Oc1ccc(N2CCN(c3ccncc3)CC2)c(-c2ccccc2)c1)C(=O)OC |
| InChI | InChI=1S/C26H29N3O3/c1-3-25(26(30)31-2)32-22-9-10-24(23(19-22)20-7-5-4-6-8-20)29-17-15-28(16-18-29)21-11-13-27-14-12-21/h4-14,19,25H,3,15-18H2,1-2H3 |
| InChIKey | ZHUKWSNADGQWDM-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|