C22H29N3O3 — CID 174358331
ethyl 3-methyl-2-phenoxy-4-(4-pyridin-4-ylpiperazin-1-yl)butanoate (PubChem CID 174358331) has the molecular formula C22H29N3O3 and a molecular weight of 383.49 g/mol. Its IUPAC name is ethyl 3-methyl-2-phenoxy-4-(4-pyridin-4-ylpiperazin-1-yl)butanoate.
| Compound Name | ethyl 3-methyl-2-phenoxy-4-(4-pyridin-4-ylpiperazin-1-yl)butanoate |
|---|---|
| PubChem CID | 174358331 |
| Molecular Formula | C22H29N3O3 |
| Molecular Weight | 383.49 g/mol |
| Exact Mass | 383.22 |
| IUPAC Name | ethyl 3-methyl-2-phenoxy-4-(4-pyridin-4-ylpiperazin-1-yl)butanoate |
| SMILES | CCOC(=O)C(Oc1ccccc1)C(C)CN1CCN(c2ccncc2)CC1 |
| InChI | InChI=1S/C22H29N3O3/c1-3-27-22(26)21(28-20-7-5-4-6-8-20)18(2)17-24-13-15-25(16-14-24)19-9-11-23-12-10-19/h4-12,18,21H,3,13-17H2,1-2H3 |
| InChIKey | RFAQFVYXGKVYJT-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.49 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |