About [benzoyl(benzyl)amino] 2-methyl-3-(4-pyridin-4-ylpiperazin-1-yl)propanoate
[benzoyl(benzyl)amino] 2-methyl-3-(4-pyridin-4-ylpiperazin-1-yl)propanoate (PubChem CID 18918240) has the molecular formula C27H30N4O3
and a molecular weight of 458.56 g/mol. Its IUPAC name is [benzoyl(benzyl)amino] 2-methyl-3-(4-pyridin-4-ylpiperazin-1-yl)propanoate.
Molecular Properties
| Compound Name | [benzoyl(benzyl)amino] 2-methyl-3-(4-pyridin-4-ylpiperazin-1-yl)propanoate |
| PubChem CID | 18918240 |
| Molecular Formula | C27H30N4O3 |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.23 |
| IUPAC Name | [benzoyl(benzyl)amino] 2-methyl-3-(4-pyridin-4-ylpiperazin-1-yl)propanoate |
| SMILES | CC(CN1CCN(c2ccncc2)CC1)C(=O)ON(Cc1ccccc1)C(=O)c1ccccc1 |
| InChI | InChI=1S/C27H30N4O3/c1-22(20-29-16-18-30(19-17-29)25-12-14-28-15-13-25)27(33)34-31(21-23-8-4-2-5-9-23)26(32)24-10-6-3-7-11-24/h2-15,22H,16-21H2,1H3 |
| InChIKey | OKXMLWLEJZJHJM-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 65.98 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [benzoyl(benzyl)amino] 2-methyl-3-(4-pyridin-4-ylpiperazin-1-yl)propanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [benzoyl(benzyl)amino] 2-methyl-3-(4-pyridin-4-ylpiperazin-1-yl)propanoate?
The IUPAC name of [benzoyl(benzyl)amino] 2-methyl-3-(4-pyridin-4-ylpiperazin-1-yl)propanoate (CID 18918240) is [benzoyl(benzyl)amino] 2-methyl-3-(4-pyridin-4-ylpiperazin-1-yl)propanoate.
What is the SMILES notation for [benzoyl(benzyl)amino] 2-methyl-3-(4-pyridin-4-ylpiperazin-1-yl)propanoate?
The canonical SMILES for [benzoyl(benzyl)amino] 2-methyl-3-(4-pyridin-4-ylpiperazin-1-yl)propanoate is CC(CN1CCN(c2ccncc2)CC1)C(=O)ON(Cc1ccccc1)C(=O)c1ccccc1.
What is the InChIKey of [benzoyl(benzyl)amino] 2-methyl-3-(4-pyridin-4-ylpiperazin-1-yl)propanoate?
The InChIKey is OKXMLWLEJZJHJM-UHFFFAOYSA-N. The full InChI is InChI=1S/C27H30N4O3/c1-22(20-29-16-18-30(19-17-29)25-12-14-28-15-13-25)27(33)34-31(21-23-8-4-2-5-9-23)26(32)24-10-6-3-7-11-24/h2-15,22H,16-21H2,1H3.
What are the key properties of [benzoyl(benzyl)amino] 2-methyl-3-(4-pyridin-4-ylpiperazin-1-yl)propanoate?
[benzoyl(benzyl)amino] 2-methyl-3-(4-pyridin-4-ylpiperazin-1-yl)propanoate has a molecular weight of 458.56 g/mol, XLogP of 3.64, 7 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [benzoyl(benzyl)amino] 2-methyl-3-(4-pyridin-4-ylpiperazin-1-yl)propanoate is sourced from PubChem (CID 18918240), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).