C14H17N3O2 — CID 70082508
ethyl 3-[3-(aminomethyl)phenyl]-5-methyl-1H-pyrazole-4-carboxylate (PubChem CID 70082508) has the molecular formula C14H17N3O2 and a molecular weight of 259.31 g/mol. Its IUPAC name is ethyl 3-[3-(aminomethyl)phenyl]-5-methyl-1H-pyrazole-4-carboxylate.
| Compound Name | ethyl 3-[3-(aminomethyl)phenyl]-5-methyl-1H-pyrazole-4-carboxylate |
|---|---|
| PubChem CID | 70082508 |
| Molecular Formula | C14H17N3O2 |
| Molecular Weight | 259.31 g/mol |
| Exact Mass | 259.13 |
| IUPAC Name | ethyl 3-[3-(aminomethyl)phenyl]-5-methyl-1H-pyrazole-4-carboxylate |
| SMILES | CCOC(=O)c1c(-c2cccc(CN)c2)n[nH]c1C |
| InChI | InChI=1S/C14H17N3O2/c1-3-19-14(18)12-9(2)16-17-13(12)11-6-4-5-10(7-11)8-15/h4-7H,3,8,15H2,1-2H3,(H,16,17) |
| InChIKey | BSNVQDMSCHMLGZ-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 81.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 259.31 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |