C14H18ClNO2 — CID 70082574
6-(4-ethoxyphenyl)-2,3-dimethyloxazine;hydrochloride (PubChem CID 70082574) has the molecular formula C14H18ClNO2 and a molecular weight of 267.76 g/mol. Its IUPAC name is 6-(4-ethoxyphenyl)-2,3-dimethyloxazine;hydrochloride.
| Compound Name | 6-(4-ethoxyphenyl)-2,3-dimethyloxazine;hydrochloride |
|---|---|
| PubChem CID | 70082574 |
| Molecular Formula | C14H18ClNO2 |
| Molecular Weight | 267.76 g/mol |
| Exact Mass | 267.10 |
| IUPAC Name | 6-(4-ethoxyphenyl)-2,3-dimethyloxazine;hydrochloride |
| SMILES | CCOc1ccc(C2=CC=C(C)N(C)O2)cc1.Cl |
| InChI | InChI=1S/C14H17NO2.ClH/c1-4-16-13-8-6-12(7-9-13)14-10-5-11(2)15(3)17-14;/h5-10H,4H2,1-3H3;1H |
| InChIKey | YVXHCWFTAJREOA-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.76 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |