C20H25NO5 — CID 70086148
2-[[2-carboxy-2-[5-(4-methylphenyl)furan-2-yl]ethyl]amino]-4-methylpentanoic acid (PubChem CID 70086148) has the molecular formula C20H25NO5 and a molecular weight of 359.42 g/mol. Its IUPAC name is 2-[[2-carboxy-2-[5-(4-methylphenyl)furan-2-yl]ethyl]amino]-4-methylpentanoic acid.
| Compound Name | 2-[[2-carboxy-2-[5-(4-methylphenyl)furan-2-yl]ethyl]amino]-4-methylpentanoic acid |
|---|---|
| PubChem CID | 70086148 |
| Molecular Formula | C20H25NO5 |
| Molecular Weight | 359.42 g/mol |
| Exact Mass | 359.17 |
| IUPAC Name | 2-[[2-carboxy-2-[5-(4-methylphenyl)furan-2-yl]ethyl]amino]-4-methylpentanoic acid |
| SMILES | Cc1ccc(-c2ccc(C(CNC(CC(C)C)C(=O)O)C(=O)O)o2)cc1 |
| InChI | InChI=1S/C20H25NO5/c1-12(2)10-16(20(24)25)21-11-15(19(22)23)18-9-8-17(26-18)14-6-4-13(3)5-7-14/h4-9,12,15-16,21H,10-11H2,1-3H3,(H,22,23)(H,24,25) |
| InChIKey | YQUSZGUCBTZRRN-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.42 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |