C25H24N2O4 — CID 70087876
3-[(2S)-4-acetamido-3-oxo-1-phenylbutan-2-yl]-2-phenoxybenzamide (PubChem CID 70087876) has the molecular formula C25H24N2O4 and a molecular weight of 416.48 g/mol. Its IUPAC name is 3-[(2S)-4-acetamido-3-oxo-1-phenylbutan-2-yl]-2-phenoxybenzamide.
| Compound Name | 3-[(2S)-4-acetamido-3-oxo-1-phenylbutan-2-yl]-2-phenoxybenzamide |
|---|---|
| PubChem CID | 70087876 |
| Molecular Formula | C25H24N2O4 |
| Molecular Weight | 416.48 g/mol |
| Exact Mass | 416.17 |
| IUPAC Name | 3-[(2S)-4-acetamido-3-oxo-1-phenylbutan-2-yl]-2-phenoxybenzamide |
| SMILES | CC(=O)NCC(=O)[C@@H](Cc1ccccc1)c1cccc(C(N)=O)c1Oc1ccccc1 |
| InChI | InChI=1S/C25H24N2O4/c1-17(28)27-16-23(29)22(15-18-9-4-2-5-10-18)20-13-8-14-21(25(26)30)24(20)31-19-11-6-3-7-12-19/h2-14,22H,15-16H2,1H3,(H2,26,30)(H,27,28)/t22-/m0/s1 |
| InChIKey | NZHZNOXZPJXHJS-QFIPXVFZSA-N |
| XLogP | 3.61 |
| TPSA | 98.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.48 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |