C29H27N3O6S2 — CID 70168277
2-(benzenesulfonamido)-3-[(2S)-4-(benzenesulfonamido)-3-oxo-1-phenylbutan-2-yl]benzamide (PubChem CID 70168277) has the molecular formula C29H27N3O6S2 and a molecular weight of 577.68 g/mol. Its IUPAC name is 2-(benzenesulfonamido)-3-[(2S)-4-(benzenesulfonamido)-3-oxo-1-phenylbutan-2-yl]benzamide.
| Compound Name | 2-(benzenesulfonamido)-3-[(2S)-4-(benzenesulfonamido)-3-oxo-1-phenylbutan-2-yl]benzamide |
|---|---|
| PubChem CID | 70168277 |
| Molecular Formula | C29H27N3O6S2 |
| Molecular Weight | 577.68 g/mol |
| Exact Mass | 577.13 |
| IUPAC Name | 2-(benzenesulfonamido)-3-[(2S)-4-(benzenesulfonamido)-3-oxo-1-phenylbutan-2-yl]benzamide |
| SMILES | NC(=O)c1cccc([C@H](Cc2ccccc2)C(=O)CNS(=O)(=O)c2ccccc2)c1NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C29H27N3O6S2/c30-29(34)25-18-10-17-24(28(25)32-40(37,38)23-15-8-3-9-16-23)26(19-21-11-4-1-5-12-21)27(33)20-31-39(35,36)22-13-6-2-7-14-22/h1-18,26,31-32H,19-20H2,(H2,30,34)/t26-/m0/s1 |
| InChIKey | ANBJTOGUCVALCG-SANMLTNESA-N |
| XLogP | 3.46 |
| TPSA | 152.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.68 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |