C20H25N3O4S — CID 149253003
2-(benzenesulfonamido)-3-N,3-N-dipropylbenzene-1,3-dicarboxamide (PubChem CID 149253003) has the molecular formula C20H25N3O4S and a molecular weight of 403.50 g/mol. Its IUPAC name is 2-(benzenesulfonamido)-3-N,3-N-dipropylbenzene-1,3-dicarboxamide.
| Compound Name | 2-(benzenesulfonamido)-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
|---|---|
| PubChem CID | 149253003 |
| Molecular Formula | C20H25N3O4S |
| Molecular Weight | 403.50 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | 2-(benzenesulfonamido)-3-N,3-N-dipropylbenzene-1,3-dicarboxamide |
| SMILES | CCCN(CCC)C(=O)c1cccc(C(N)=O)c1NS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C20H25N3O4S/c1-3-13-23(14-4-2)20(25)17-12-8-11-16(19(21)24)18(17)22-28(26,27)15-9-6-5-7-10-15/h5-12,22H,3-4,13-14H2,1-2H3,(H2,21,24) |
| InChIKey | UDNDGEJWYVOJEN-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.50 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |