C18H19N5O2S — CID 70089616
2-[2-[2-(isoquinolin-5-ylsulfonylamino)ethyl]phenyl]guanidine (PubChem CID 70089616) has the molecular formula C18H19N5O2S and a molecular weight of 369.45 g/mol. Its IUPAC name is 2-[2-[2-(isoquinolin-5-ylsulfonylamino)ethyl]phenyl]guanidine.
| Compound Name | 2-[2-[2-(isoquinolin-5-ylsulfonylamino)ethyl]phenyl]guanidine |
|---|---|
| PubChem CID | 70089616 |
| Molecular Formula | C18H19N5O2S |
| Molecular Weight | 369.45 g/mol |
| Exact Mass | 369.13 |
| IUPAC Name | 2-[2-[2-(isoquinolin-5-ylsulfonylamino)ethyl]phenyl]guanidine |
| SMILES | NC(N)=Nc1ccccc1CCNS(=O)(=O)c1cccc2cnccc12 |
| InChI | InChI=1S/C18H19N5O2S/c19-18(20)23-16-6-2-1-4-13(16)8-11-22-26(24,25)17-7-3-5-14-12-21-10-9-15(14)17/h1-7,9-10,12,22H,8,11H2,(H4,19,20,23) |
| InChIKey | FGCVHMHVROWVJC-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 123.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.45 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|