C20H21N3O4S — CID 70089901
benzyl N-[1-(isoquinolin-5-ylsulfonylamino)propan-2-yl]carbamate (PubChem CID 70089901) has the molecular formula C20H21N3O4S and a molecular weight of 399.47 g/mol. Its IUPAC name is benzyl N-[1-(isoquinolin-5-ylsulfonylamino)propan-2-yl]carbamate.
| Compound Name | benzyl N-[1-(isoquinolin-5-ylsulfonylamino)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 70089901 |
| Molecular Formula | C20H21N3O4S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | benzyl N-[1-(isoquinolin-5-ylsulfonylamino)propan-2-yl]carbamate |
| SMILES | CC(CNS(=O)(=O)c1cccc2cnccc12)NC(=O)OCc1ccccc1 |
| InChI | InChI=1S/C20H21N3O4S/c1-15(23-20(24)27-14-16-6-3-2-4-7-16)12-22-28(25,26)19-9-5-8-17-13-21-11-10-18(17)19/h2-11,13,15,22H,12,14H2,1H3,(H,23,24) |
| InChIKey | LWRBUXYJWWEISI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |