C19H18ClN3O4S — CID 14820602
benzyl N-[2-[(5-chloroisoquinolin-8-yl)sulfonylamino]ethyl]carbamate (PubChem CID 14820602) has the molecular formula C19H18ClN3O4S and a molecular weight of 419.89 g/mol. Its IUPAC name is benzyl N-[2-[(5-chloroisoquinolin-8-yl)sulfonylamino]ethyl]carbamate.
| Compound Name | benzyl N-[2-[(5-chloroisoquinolin-8-yl)sulfonylamino]ethyl]carbamate |
|---|---|
| PubChem CID | 14820602 |
| Molecular Formula | C19H18ClN3O4S |
| Molecular Weight | 419.89 g/mol |
| Exact Mass | 419.07 |
| IUPAC Name | benzyl N-[2-[(5-chloroisoquinolin-8-yl)sulfonylamino]ethyl]carbamate |
| SMILES | O=C(NCCNS(=O)(=O)c1ccc(Cl)c2ccncc12)OCc1ccccc1 |
| InChI | InChI=1S/C19H18ClN3O4S/c20-17-6-7-18(16-12-21-9-8-15(16)17)28(25,26)23-11-10-22-19(24)27-13-14-4-2-1-3-5-14/h1-9,12,23H,10-11,13H2,(H,22,24) |
| InChIKey | JZAXUPHDDJICKI-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 97.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.89 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|