C19H24FNO2S — CID 70090592
3-(4-fluorophenyl)sulfonyl-N-methyl-N-(2-phenylethyl)butan-1-amine (PubChem CID 70090592) has the molecular formula C19H24FNO2S and a molecular weight of 349.47 g/mol. Its IUPAC name is 3-(4-fluorophenyl)sulfonyl-N-methyl-N-(2-phenylethyl)butan-1-amine.
| Compound Name | 3-(4-fluorophenyl)sulfonyl-N-methyl-N-(2-phenylethyl)butan-1-amine |
|---|---|
| PubChem CID | 70090592 |
| Molecular Formula | C19H24FNO2S |
| Molecular Weight | 349.47 g/mol |
| Exact Mass | 349.15 |
| IUPAC Name | 3-(4-fluorophenyl)sulfonyl-N-methyl-N-(2-phenylethyl)butan-1-amine |
| SMILES | CC(CCN(C)CCc1ccccc1)S(=O)(=O)c1ccc(F)cc1 |
| InChI | InChI=1S/C19H24FNO2S/c1-16(24(22,23)19-10-8-18(20)9-11-19)12-14-21(2)15-13-17-6-4-3-5-7-17/h3-11,16H,12-15H2,1-2H3 |
| InChIKey | QIWKHDSAHXGICP-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.47 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |