C24H30N2O6S — CID 70091988
but-2-enedioic acid;[2-[[4-[(dimethylamino)methyl]cyclohexyl]methoxy]-3-pyridinyl]-thiophen-2-ylmethanone (PubChem CID 70091988) has the molecular formula C24H30N2O6S and a molecular weight of 474.58 g/mol. Its IUPAC name is but-2-enedioic acid;[2-[[4-[(dimethylamino)methyl]cyclohexyl]methoxy]-3-pyridinyl]-thiophen-2-ylmethanone.
| Compound Name | but-2-enedioic acid;[2-[[4-[(dimethylamino)methyl]cyclohexyl]methoxy]-3-pyridinyl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 70091988 |
| Molecular Formula | C24H30N2O6S |
| Molecular Weight | 474.58 g/mol |
| Exact Mass | 474.18 |
| IUPAC Name | but-2-enedioic acid;[2-[[4-[(dimethylamino)methyl]cyclohexyl]methoxy]-3-pyridinyl]-thiophen-2-ylmethanone |
| SMILES | CN(C)CC1CCC(COc2ncccc2C(=O)c2cccs2)CC1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C20H26N2O2S.C4H4O4/c1-22(2)13-15-7-9-16(10-8-15)14-24-20-17(5-3-11-21-20)19(23)18-6-4-12-25-18;5-3(6)1-2-4(7)8/h3-6,11-12,15-16H,7-10,13-14H2,1-2H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | GCRXAYQXCZXDMY-UHFFFAOYSA-N |
| XLogP | 3.83 |
| TPSA | 117.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.58 |
| LogP ≤ 5 | 3.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|