C23H30N2O6S — CID 70091745
(Z)-but-2-enedioic acid;[2-[6-(dimethylamino)hexoxy]-6-methyl-3-pyridinyl]-thiophen-2-ylmethanone (PubChem CID 70091745) has the molecular formula C23H30N2O6S and a molecular weight of 462.57 g/mol. Its IUPAC name is (Z)-but-2-enedioic acid;[2-[6-(dimethylamino)hexoxy]-6-methyl-3-pyridinyl]-thiophen-2-ylmethanone.
| Compound Name | (Z)-but-2-enedioic acid;[2-[6-(dimethylamino)hexoxy]-6-methyl-3-pyridinyl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 70091745 |
| Molecular Formula | C23H30N2O6S |
| Molecular Weight | 462.57 g/mol |
| Exact Mass | 462.18 |
| IUPAC Name | (Z)-but-2-enedioic acid;[2-[6-(dimethylamino)hexoxy]-6-methyl-3-pyridinyl]-thiophen-2-ylmethanone |
| SMILES | Cc1ccc(C(=O)c2cccs2)c(OCCCCCCN(C)C)n1.O=C(O)/C=C\C(=O)O |
| InChI | InChI=1S/C19H26N2O2S.C4H4O4/c1-15-10-11-16(18(22)17-9-8-14-24-17)19(20-15)23-13-7-5-4-6-12-21(2)3;5-3(6)1-2-4(7)8/h8-11,14H,4-7,12-13H2,1-3H3;1-2H,(H,5,6)(H,7,8)/b;2-1- |
| InChIKey | FXLPWHGNCRNLDC-BTJKTKAUSA-N |
| XLogP | 3.90 |
| TPSA | 117.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.57 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|