C28H32N2O6S2 — CID 70088333
but-2-enedioic acid;[2-[4-[6-(dimethylamino)hexoxy]phenyl]sulfanyl-3-pyridinyl]-thiophen-2-ylmethanone (PubChem CID 70088333) has the molecular formula C28H32N2O6S2 and a molecular weight of 556.71 g/mol. Its IUPAC name is but-2-enedioic acid;[2-[4-[6-(dimethylamino)hexoxy]phenyl]sulfanyl-3-pyridinyl]-thiophen-2-ylmethanone.
| Compound Name | but-2-enedioic acid;[2-[4-[6-(dimethylamino)hexoxy]phenyl]sulfanyl-3-pyridinyl]-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 70088333 |
| Molecular Formula | C28H32N2O6S2 |
| Molecular Weight | 556.71 g/mol |
| Exact Mass | 556.17 |
| IUPAC Name | but-2-enedioic acid;[2-[4-[6-(dimethylamino)hexoxy]phenyl]sulfanyl-3-pyridinyl]-thiophen-2-ylmethanone |
| SMILES | CN(C)CCCCCCOc1ccc(Sc2ncccc2C(=O)c2cccs2)cc1.O=C(O)C=CC(=O)O |
| InChI | InChI=1S/C24H28N2O2S2.C4H4O4/c1-26(2)16-5-3-4-6-17-28-19-11-13-20(14-12-19)30-24-21(9-7-15-25-24)23(27)22-10-8-18-29-22;5-3(6)1-2-4(7)8/h7-15,18H,3-6,16-17H2,1-2H3;1-2H,(H,5,6)(H,7,8) |
| InChIKey | QRNZYVFVZDNGKI-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 117.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.71 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|