C14H14O3S — CID 5151105
(2-hydroxy-4-propoxyphenyl)-thiophen-2-ylmethanone (PubChem CID 5151105) has the molecular formula C14H14O3S and a molecular weight of 262.33 g/mol. Its IUPAC name is (2-hydroxy-4-propoxyphenyl)-thiophen-2-ylmethanone.
| Compound Name | (2-hydroxy-4-propoxyphenyl)-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 5151105 |
| Molecular Formula | C14H14O3S |
| Molecular Weight | 262.33 g/mol |
| Exact Mass | 262.07 |
| IUPAC Name | (2-hydroxy-4-propoxyphenyl)-thiophen-2-ylmethanone |
| SMILES | CCCOc1ccc(C(=O)c2cccs2)c(O)c1 |
| InChI | InChI=1S/C14H14O3S/c1-2-7-17-10-5-6-11(12(15)9-10)14(16)13-4-3-8-18-13/h3-6,8-9,15H,2,7H2,1H3 |
| InChIKey | ZAWKFVYHGXRMLA-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.33 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |