C24H25ClN2O4 — CID 70092414
(2S)-2-amino-3-[4-[(3-chlorophenyl)methoxy]phenyl]propanoic acid;1-(4-aminophenyl)ethanone (PubChem CID 70092414) has the molecular formula C24H25ClN2O4 and a molecular weight of 440.93 g/mol. Its IUPAC name is (2S)-2-amino-3-[4-[(3-chlorophenyl)methoxy]phenyl]propanoic acid;1-(4-aminophenyl)ethanone.
| Compound Name | (2S)-2-amino-3-[4-[(3-chlorophenyl)methoxy]phenyl]propanoic acid;1-(4-aminophenyl)ethanone |
|---|---|
| PubChem CID | 70092414 |
| Molecular Formula | C24H25ClN2O4 |
| Molecular Weight | 440.93 g/mol |
| Exact Mass | 440.15 |
| IUPAC Name | (2S)-2-amino-3-[4-[(3-chlorophenyl)methoxy]phenyl]propanoic acid;1-(4-aminophenyl)ethanone |
| SMILES | CC(=O)c1ccc(N)cc1.N[C@@H](Cc1ccc(OCc2cccc(Cl)c2)cc1)C(=O)O |
| InChI | InChI=1S/C16H16ClNO3.C8H9NO/c17-13-3-1-2-12(8-13)10-21-14-6-4-11(5-7-14)9-15(18)16(19)20;1-6(10)7-2-4-8(9)5-3-7/h1-8,15H,9-10,18H2,(H,19,20);2-5H,9H2,1H3/t15-;/m0./s1 |
| InChIKey | LMPSFMJHHFRWQE-RSAXXLAASA-N |
| XLogP | 4.34 |
| TPSA | 115.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.93 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|