C22H31NO3S — CID 70093346
tert-butyl N-(4-hexylsulfanyl-3-hydroxy-8-methylnaphthalen-2-yl)carbamate (PubChem CID 70093346) has the molecular formula C22H31NO3S and a molecular weight of 389.56 g/mol. Its IUPAC name is tert-butyl N-(4-hexylsulfanyl-3-hydroxy-8-methylnaphthalen-2-yl)carbamate.
| Compound Name | tert-butyl N-(4-hexylsulfanyl-3-hydroxy-8-methylnaphthalen-2-yl)carbamate |
|---|---|
| PubChem CID | 70093346 |
| Molecular Formula | C22H31NO3S |
| Molecular Weight | 389.56 g/mol |
| Exact Mass | 389.20 |
| IUPAC Name | tert-butyl N-(4-hexylsulfanyl-3-hydroxy-8-methylnaphthalen-2-yl)carbamate |
| SMILES | CCCCCCSc1c(O)c(NC(=O)OC(C)(C)C)cc2c(C)cccc12 |
| InChI | InChI=1S/C22H31NO3S/c1-6-7-8-9-13-27-20-16-12-10-11-15(2)17(16)14-18(19(20)24)23-21(25)26-22(3,4)5/h10-12,14,24H,6-9,13H2,1-5H3,(H,23,25) |
| InChIKey | DKNWBPWKPYRUQO-UHFFFAOYSA-N |
| XLogP | 6.87 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.56 |
| LogP ≤ 5 | 6.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|