C22H28ClN3O4 — CID 70094763
acetic acid;[4-[[3-[(2-chlorophenyl)methoxy]phenoxy]methyl]piperidin-1-yl]methylidenehydrazine (PubChem CID 70094763) has the molecular formula C22H28ClN3O4 and a molecular weight of 433.94 g/mol. Its IUPAC name is acetic acid;[4-[[3-[(2-chlorophenyl)methoxy]phenoxy]methyl]piperidin-1-yl]methylidenehydrazine.
| Compound Name | acetic acid;[4-[[3-[(2-chlorophenyl)methoxy]phenoxy]methyl]piperidin-1-yl]methylidenehydrazine |
|---|---|
| PubChem CID | 70094763 |
| Molecular Formula | C22H28ClN3O4 |
| Molecular Weight | 433.94 g/mol |
| Exact Mass | 433.18 |
| IUPAC Name | acetic acid;[4-[[3-[(2-chlorophenyl)methoxy]phenoxy]methyl]piperidin-1-yl]methylidenehydrazine |
| SMILES | CC(=O)O.NN=CN1CCC(COc2cccc(OCc3ccccc3Cl)c2)CC1 |
| InChI | InChI=1S/C20H24ClN3O2.C2H4O2/c21-20-7-2-1-4-17(20)14-26-19-6-3-5-18(12-19)25-13-16-8-10-24(11-9-16)15-23-22;1-2(3)4/h1-7,12,15-16H,8-11,13-14,22H2;1H3,(H,3,4) |
| InChIKey | JUVLTXNPCPRYKW-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 97.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.94 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|